C13H20N6O — CID 114785237
2-N,6-N-dimethyl-6-N-(oxan-4-ylmethyl)-7H-purine-2,6-diamine (PubChem CID 114785237) has the molecular formula C13H20N6O and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-N,6-N-dimethyl-6-N-(oxan-4-ylmethyl)-7H-purine-2,6-diamine.
| Compound Name | 2-N,6-N-dimethyl-6-N-(oxan-4-ylmethyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114785237 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2-N,6-N-dimethyl-6-N-(oxan-4-ylmethyl)-7H-purine-2,6-diamine |
| SMILES | CNc1nc(N(C)CC2CCOCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H20N6O/c1-14-13-17-11-10(15-8-16-11)12(18-13)19(2)7-9-3-5-20-6-4-9/h8-9H,3-7H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | BZOBRUVYCQUGRH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |