C18H30N4O2 — CID 75478549
2-N,3-N-dimethyl-2-N,3-N-bis(oxan-4-ylmethyl)pyrazine-2,3-diamine (PubChem CID 75478549) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-N,3-N-dimethyl-2-N,3-N-bis(oxan-4-ylmethyl)pyrazine-2,3-diamine.
| Compound Name | 2-N,3-N-dimethyl-2-N,3-N-bis(oxan-4-ylmethyl)pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 75478549 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 2-N,3-N-dimethyl-2-N,3-N-bis(oxan-4-ylmethyl)pyrazine-2,3-diamine |
| SMILES | CN(CC1CCOCC1)c1nccnc1N(C)CC1CCOCC1 |
| InChI | InChI=1S/C18H30N4O2/c1-21(13-15-3-9-23-10-4-15)17-18(20-8-7-19-17)22(2)14-16-5-11-24-12-6-16/h7-8,15-16H,3-6,9-14H2,1-2H3 |
| InChIKey | WQQLJXSHDKBSGX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |