C12H20N4O — CID 63727442
3-(aminomethyl)-N-methyl-N-(oxan-3-ylmethyl)pyrazin-2-amine (PubChem CID 63727442) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-(aminomethyl)-N-methyl-N-(oxan-3-ylmethyl)pyrazin-2-amine.
| Compound Name | 3-(aminomethyl)-N-methyl-N-(oxan-3-ylmethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 63727442 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3-(aminomethyl)-N-methyl-N-(oxan-3-ylmethyl)pyrazin-2-amine |
| SMILES | CN(CC1CCCOC1)c1nccnc1CN |
| InChI | InChI=1S/C12H20N4O/c1-16(8-10-3-2-6-17-9-10)12-11(7-13)14-4-5-15-12/h4-5,10H,2-3,6-9,13H2,1H3 |
| InChIKey | FELKVAPVMHRNCU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |