C12H15F3N2O — CID 114072561
3,5,6-trifluoro-N-methyl-N-(oxan-3-ylmethyl)pyridin-2-amine (PubChem CID 114072561) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 3,5,6-trifluoro-N-methyl-N-(oxan-3-ylmethyl)pyridin-2-amine.
| Compound Name | 3,5,6-trifluoro-N-methyl-N-(oxan-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114072561 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3,5,6-trifluoro-N-methyl-N-(oxan-3-ylmethyl)pyridin-2-amine |
| SMILES | CN(CC1CCCOC1)c1nc(F)c(F)cc1F |
| InChI | InChI=1S/C12H15F3N2O/c1-17(6-8-3-2-4-18-7-8)12-10(14)5-9(13)11(15)16-12/h5,8H,2-4,6-7H2,1H3 |
| InChIKey | RFUPKDSXISBHFW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|