C14H22BrN3O — CID 63708110
5-bromo-N-methyl-3-(methylaminomethyl)-N-(oxan-3-ylmethyl)pyridin-2-amine (PubChem CID 63708110) has the molecular formula C14H22BrN3O and a molecular weight of 328.25 g/mol. Its IUPAC name is 5-bromo-N-methyl-3-(methylaminomethyl)-N-(oxan-3-ylmethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-methyl-3-(methylaminomethyl)-N-(oxan-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63708110 |
| Molecular Formula | C14H22BrN3O |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 5-bromo-N-methyl-3-(methylaminomethyl)-N-(oxan-3-ylmethyl)pyridin-2-amine |
| SMILES | CNCc1cc(Br)cnc1N(C)CC1CCCOC1 |
| InChI | InChI=1S/C14H22BrN3O/c1-16-7-12-6-13(15)8-17-14(12)18(2)9-11-4-3-5-19-10-11/h6,8,11,16H,3-5,7,9-10H2,1-2H3 |
| InChIKey | RJPNUZJNPXYYAF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |