C12H16BrFN2O — CID 129413889
5-bromo-3-fluoro-N-methyl-N-[[(3S)-oxan-3-yl]methyl]pyridin-2-amine (PubChem CID 129413889) has the molecular formula C12H16BrFN2O and a molecular weight of 303.17 g/mol. Its IUPAC name is 5-bromo-3-fluoro-N-methyl-N-[[(3S)-oxan-3-yl]methyl]pyridin-2-amine.
| Compound Name | 5-bromo-3-fluoro-N-methyl-N-[[(3S)-oxan-3-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 129413889 |
| Molecular Formula | C12H16BrFN2O |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 5-bromo-3-fluoro-N-methyl-N-[[(3S)-oxan-3-yl]methyl]pyridin-2-amine |
| SMILES | CN(C[C@@H]1CCCOC1)c1ncc(Br)cc1F |
| InChI | InChI=1S/C12H16BrFN2O/c1-16(7-9-3-2-4-17-8-9)12-11(14)5-10(13)6-15-12/h5-6,9H,2-4,7-8H2,1H3/t9-/m0/s1 |
| InChIKey | VLUQYNNQZWIZGR-VIFPVBQESA-N |
| XLogP | 2.85 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |