C12H14N6O — CID 114783888
6-N-(furan-2-ylmethyl)-2-N,6-N-dimethyl-7H-purine-2,6-diamine (PubChem CID 114783888) has the molecular formula C12H14N6O and a molecular weight of 258.28 g/mol. Its IUPAC name is 6-N-(furan-2-ylmethyl)-2-N,6-N-dimethyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-(furan-2-ylmethyl)-2-N,6-N-dimethyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114783888 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 6-N-(furan-2-ylmethyl)-2-N,6-N-dimethyl-7H-purine-2,6-diamine |
| SMILES | CNc1nc(N(C)Cc2ccco2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H14N6O/c1-13-12-16-10-9(14-7-15-10)11(17-12)18(2)6-8-4-3-5-19-8/h3-5,7H,6H2,1-2H3,(H2,13,14,15,16,17) |
| InChIKey | KJAOIQUKVUKSON-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |