C12H12ClN5O — CID 104787205
2-chloro-N-ethyl-N-(furan-2-ylmethyl)-7H-purin-6-amine (PubChem CID 104787205) has the molecular formula C12H12ClN5O and a molecular weight of 277.71 g/mol. Its IUPAC name is 2-chloro-N-ethyl-N-(furan-2-ylmethyl)-7H-purin-6-amine.
| Compound Name | 2-chloro-N-ethyl-N-(furan-2-ylmethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 104787205 |
| Molecular Formula | C12H12ClN5O |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-chloro-N-ethyl-N-(furan-2-ylmethyl)-7H-purin-6-amine |
| SMILES | CCN(Cc1ccco1)c1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H12ClN5O/c1-2-18(6-8-4-3-5-19-8)11-9-10(15-7-14-9)16-12(13)17-11/h3-5,7H,2,6H2,1H3,(H,14,15,16,17) |
| InChIKey | QHRYSEFGWLSETA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |