C10H11ClF3N5 — CID 104787282
2-chloro-N-propyl-N-(2,2,2-trifluoroethyl)-7H-purin-6-amine (PubChem CID 104787282) has the molecular formula C10H11ClF3N5 and a molecular weight of 293.68 g/mol. Its IUPAC name is 2-chloro-N-propyl-N-(2,2,2-trifluoroethyl)-7H-purin-6-amine.
| Compound Name | 2-chloro-N-propyl-N-(2,2,2-trifluoroethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 104787282 |
| Molecular Formula | C10H11ClF3N5 |
| Molecular Weight | 293.68 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-chloro-N-propyl-N-(2,2,2-trifluoroethyl)-7H-purin-6-amine |
| SMILES | CCCN(CC(F)(F)F)c1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H11ClF3N5/c1-2-3-19(4-10(12,13)14)8-6-7(16-5-15-6)17-9(11)18-8/h5H,2-4H2,1H3,(H,15,16,17,18) |
| InChIKey | CHWDXXIQOVLKCB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.68 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |