C12H9ClFN5 — CID 104787295
2-chloro-N-(4-fluorophenyl)-N-methyl-7H-purin-6-amine (PubChem CID 104787295) has the molecular formula C12H9ClFN5 and a molecular weight of 277.69 g/mol. Its IUPAC name is 2-chloro-N-(4-fluorophenyl)-N-methyl-7H-purin-6-amine.
| Compound Name | 2-chloro-N-(4-fluorophenyl)-N-methyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 104787295 |
| Molecular Formula | C12H9ClFN5 |
| Molecular Weight | 277.69 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-chloro-N-(4-fluorophenyl)-N-methyl-7H-purin-6-amine |
| SMILES | CN(c1ccc(F)cc1)c1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H9ClFN5/c1-19(8-4-2-7(14)3-5-8)11-9-10(16-6-15-9)17-12(13)18-11/h2-6H,1H3,(H,15,16,17,18) |
| InChIKey | YBUUCOGFDKAKOO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.69 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |