C10H16N6 — CID 114783569
6-N,6-N-diethyl-2-N-methyl-7H-purine-2,6-diamine (PubChem CID 114783569) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is 6-N,6-N-diethyl-2-N-methyl-7H-purine-2,6-diamine.
| Compound Name | 6-N,6-N-diethyl-2-N-methyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114783569 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 6-N,6-N-diethyl-2-N-methyl-7H-purine-2,6-diamine |
| SMILES | CCN(CC)c1nc(NC)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H16N6/c1-4-16(5-2)9-7-8(13-6-12-7)14-10(11-3)15-9/h6H,4-5H2,1-3H3,(H2,11,12,13,14,15) |
| InChIKey | FPWIGOUQQVAPSJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |