C14H13N7 — CID 114785699
2-[methyl-[2-(methylamino)-7H-purin-6-yl]amino]benzonitrile (PubChem CID 114785699) has the molecular formula C14H13N7 and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-[methyl-[2-(methylamino)-7H-purin-6-yl]amino]benzonitrile.
| Compound Name | 2-[methyl-[2-(methylamino)-7H-purin-6-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 114785699 |
| Molecular Formula | C14H13N7 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-[methyl-[2-(methylamino)-7H-purin-6-yl]amino]benzonitrile |
| SMILES | CNc1nc(N(C)c2ccccc2C#N)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H13N7/c1-16-14-19-12-11(17-8-18-12)13(20-14)21(2)10-6-4-3-5-9(10)7-15/h3-6,8H,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | MTDRFBVGHBIESR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |