C23H18ClN5 — CID 141230720
N-benzyl-2-chloro-N-(naphthalen-1-ylmethyl)-7H-purin-6-amine (PubChem CID 141230720) has the molecular formula C23H18ClN5 and a molecular weight of 399.89 g/mol. Its IUPAC name is N-benzyl-2-chloro-N-(naphthalen-1-ylmethyl)-7H-purin-6-amine.
| Compound Name | N-benzyl-2-chloro-N-(naphthalen-1-ylmethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 141230720 |
| Molecular Formula | C23H18ClN5 |
| Molecular Weight | 399.89 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-benzyl-2-chloro-N-(naphthalen-1-ylmethyl)-7H-purin-6-amine |
| SMILES | Clc1nc(N(Cc2ccccc2)Cc2cccc3ccccc23)c2[nH]cnc2n1 |
| InChI | InChI=1S/C23H18ClN5/c24-23-27-21-20(25-15-26-21)22(28-23)29(13-16-7-2-1-3-8-16)14-18-11-6-10-17-9-4-5-12-19(17)18/h1-12,15H,13-14H2,(H,25,26,27,28) |
| InChIKey | QVWYPSTUXXSNBR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.89 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |