C12H19N7O — CID 115669354
2-[(2-amino-7H-purin-6-yl)-methylamino]-N,N-diethylacetamide (PubChem CID 115669354) has the molecular formula C12H19N7O and a molecular weight of 277.33 g/mol. Its IUPAC name is 2-[(2-amino-7H-purin-6-yl)-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[(2-amino-7H-purin-6-yl)-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 115669354 |
| Molecular Formula | C12H19N7O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2-[(2-amino-7H-purin-6-yl)-methylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C)c1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H19N7O/c1-4-19(5-2)8(20)6-18(3)11-9-10(15-7-14-9)16-12(13)17-11/h7H,4-6H2,1-3H3,(H3,13,14,15,16,17) |
| InChIKey | LFCMHHQMVPOTSF-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |