C11H19N5O — CID 115978158
2-[(4-aminopyrimidin-2-yl)-methylamino]-N,N-diethylacetamide (PubChem CID 115978158) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 2-[(4-aminopyrimidin-2-yl)-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[(4-aminopyrimidin-2-yl)-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 115978158 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 2-[(4-aminopyrimidin-2-yl)-methylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C)c1nccc(N)n1 |
| InChI | InChI=1S/C11H19N5O/c1-4-16(5-2)10(17)8-15(3)11-13-7-6-9(12)14-11/h6-7H,4-5,8H2,1-3H3,(H2,12,13,14) |
| InChIKey | WFAZWZGPMKIZSI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |