C13H17FN6 — CID 80794162
2-N-[(2-fluorophenyl)methyl]-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80794162) has the molecular formula C13H17FN6 and a molecular weight of 276.32 g/mol. Its IUPAC name is 2-N-[(2-fluorophenyl)methyl]-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(2-fluorophenyl)methyl]-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80794162 |
| Molecular Formula | C13H17FN6 |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-N-[(2-fluorophenyl)methyl]-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(N)nc(N(C)Cc2ccccc2F)n1 |
| InChI | InChI=1S/C13H17FN6/c1-19(2)12-16-11(15)17-13(18-12)20(3)8-9-6-4-5-7-10(9)14/h4-7H,8H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | UZOMKSCZYCCDMS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |