C14H15FN2 — CID 39247780
3-N-[(2-fluorophenyl)methyl]-3-N-methylbenzene-1,3-diamine (PubChem CID 39247780) has the molecular formula C14H15FN2 and a molecular weight of 230.29 g/mol. Its IUPAC name is 3-N-[(2-fluorophenyl)methyl]-3-N-methylbenzene-1,3-diamine.
| Compound Name | 3-N-[(2-fluorophenyl)methyl]-3-N-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 39247780 |
| Molecular Formula | C14H15FN2 |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 3-N-[(2-fluorophenyl)methyl]-3-N-methylbenzene-1,3-diamine |
| SMILES | CN(Cc1ccccc1F)c1cccc(N)c1 |
| InChI | InChI=1S/C14H15FN2/c1-17(13-7-4-6-12(16)9-13)10-11-5-2-3-8-14(11)15/h2-9H,10,16H2,1H3 |
| InChIKey | RBWRNCUNRVELHP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|