C12H14N4 — CID 62698436
3-N-methyl-3-N-(pyrimidin-2-ylmethyl)benzene-1,3-diamine (PubChem CID 62698436) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-N-methyl-3-N-(pyrimidin-2-ylmethyl)benzene-1,3-diamine.
| Compound Name | 3-N-methyl-3-N-(pyrimidin-2-ylmethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 62698436 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 3-N-methyl-3-N-(pyrimidin-2-ylmethyl)benzene-1,3-diamine |
| SMILES | CN(Cc1ncccn1)c1cccc(N)c1 |
| InChI | InChI=1S/C12H14N4/c1-16(9-12-14-6-3-7-15-12)11-5-2-4-10(13)8-11/h2-8H,9,13H2,1H3 |
| InChIKey | REHDUKVBSTULFF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|