C10H12N2 — CID 130948301
3-N-methyl-3-N-prop-2-ynylbenzene-1,3-diamine (PubChem CID 130948301) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-N-methyl-3-N-prop-2-ynylbenzene-1,3-diamine.
| Compound Name | 3-N-methyl-3-N-prop-2-ynylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 130948301 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3-N-methyl-3-N-prop-2-ynylbenzene-1,3-diamine |
| SMILES | C#CCN(C)c1cccc(N)c1 |
| InChI | InChI=1S/C10H12N2/c1-3-7-12(2)10-6-4-5-9(11)8-10/h1,4-6,8H,7,11H2,2H3 |
| InChIKey | NENJRDLCKDVESQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|