C19H22N6O2 — CID 70938061
2-[[[4-amino-6-[(2-hydroxyphenyl)methyl-methylamino]-1,3,5-triazin-2-yl]-methylamino]methyl]phenol (PubChem CID 70938061) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 2-[[[4-amino-6-[(2-hydroxyphenyl)methyl-methylamino]-1,3,5-triazin-2-yl]-methylamino]methyl]phenol.
| Compound Name | 2-[[[4-amino-6-[(2-hydroxyphenyl)methyl-methylamino]-1,3,5-triazin-2-yl]-methylamino]methyl]phenol |
|---|---|
| PubChem CID | 70938061 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-[[[4-amino-6-[(2-hydroxyphenyl)methyl-methylamino]-1,3,5-triazin-2-yl]-methylamino]methyl]phenol |
| SMILES | CN(Cc1ccccc1O)c1nc(N)nc(N(C)Cc2ccccc2O)n1 |
| InChI | InChI=1S/C19H22N6O2/c1-24(11-13-7-3-5-9-15(13)26)18-21-17(20)22-19(23-18)25(2)12-14-8-4-6-10-16(14)27/h3-10,26-27H,11-12H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | CXWTXZYWDSAXRI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|