About benzene-1,3-diamine;2-[(dimethylamino)methyl]phenol;formaldehyde
benzene-1,3-diamine;2-[(dimethylamino)methyl]phenol;formaldehyde (PubChem CID 6455837) has the molecular formula C16H23N3O2
and a molecular weight of 289.38 g/mol. Its IUPAC name is benzene-1,3-diamine;2-[(dimethylamino)methyl]phenol;formaldehyde.
Molecular Properties
| Compound Name | benzene-1,3-diamine;2-[(dimethylamino)methyl]phenol;formaldehyde |
| PubChem CID | 6455837 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | benzene-1,3-diamine;2-[(dimethylamino)methyl]phenol;formaldehyde |
| SMILES | C=O.CN(C)Cc1ccccc1O.Nc1cccc(N)c1 |
| InChI | InChI=1S/C9H13NO.C6H8N2.CH2O/c1-10(2)7-8-5-3-4-6-9(8)11;7-5-2-1-3-6(8)4-5;1-2/h3-6,11H,7H2,1-2H3;1-4H,7-8H2;1H2 |
| InChIKey | SPJKDIUSHWSXAX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,3-diamine;2-[(dimethylamino)methyl]phenol;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-diamine;2-[(dimethylamino)methyl]phenol;formaldehyde?
The IUPAC name of benzene-1,3-diamine;2-[(dimethylamino)methyl]phenol;formaldehyde (CID 6455837) is benzene-1,3-diamine;2-[(dimethylamino)methyl]phenol;formaldehyde.
What is the SMILES notation for benzene-1,3-diamine;2-[(dimethylamino)methyl]phenol;formaldehyde?
The canonical SMILES for benzene-1,3-diamine;2-[(dimethylamino)methyl]phenol;formaldehyde is C=O.CN(C)Cc1ccccc1O.Nc1cccc(N)c1.
What is the InChIKey of benzene-1,3-diamine;2-[(dimethylamino)methyl]phenol;formaldehyde?
The InChIKey is SPJKDIUSHWSXAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.C6H8N2.CH2O/c1-10(2)7-8-5-3-4-6-9(8)11;7-5-2-1-3-6(8)4-5;1-2/h3-6,11H,7H2,1-2H3;1-4H,7-8H2;1H2.
What are the key properties of benzene-1,3-diamine;2-[(dimethylamino)methyl]phenol;formaldehyde?
benzene-1,3-diamine;2-[(dimethylamino)methyl]phenol;formaldehyde has a molecular weight of 289.38 g/mol, XLogP of 2.12, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diamine;2-[(dimethylamino)methyl]phenol;formaldehyde is sourced from PubChem (CID 6455837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).