C17H21N3O — CID 133462148
2-[[methyl-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)amino]methyl]phenol (PubChem CID 133462148) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-[[methyl-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)amino]methyl]phenol.
| Compound Name | 2-[[methyl-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 133462148 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-[[methyl-(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)amino]methyl]phenol |
| SMILES | Cc1nc2c(c(N(C)Cc3ccccc3O)n1)CCCC2 |
| InChI | InChI=1S/C17H21N3O/c1-12-18-15-9-5-4-8-14(15)17(19-12)20(2)11-13-7-3-6-10-16(13)21/h3,6-7,10,21H,4-5,8-9,11H2,1-2H3 |
| InChIKey | ZEKNCZAUTQUZAC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|