C14H10ClF4N5 — CID 167742916
N-[(3-chloro-4-fluorophenyl)methyl]-N-methyl-2-(trifluoromethyl)-7H-purin-6-amine (PubChem CID 167742916) has the molecular formula C14H10ClF4N5 and a molecular weight of 359.71 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-N-methyl-2-(trifluoromethyl)-7H-purin-6-amine.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-N-methyl-2-(trifluoromethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 167742916 |
| Molecular Formula | C14H10ClF4N5 |
| Molecular Weight | 359.71 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-N-methyl-2-(trifluoromethyl)-7H-purin-6-amine |
| SMILES | CN(Cc1ccc(F)c(Cl)c1)c1nc(C(F)(F)F)nc2nc[nH]c12 |
| InChI | InChI=1S/C14H10ClF4N5/c1-24(5-7-2-3-9(16)8(15)4-7)12-10-11(21-6-20-10)22-13(23-12)14(17,18)19/h2-4,6H,5H2,1H3,(H,20,21,22,23) |
| InChIKey | DYAYHZSSEIYUJW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.71 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |