C14H10ClFN4S — CID 122686940
N-(3-chloro-4-fluorophenyl)-N-methyl-1H-imidazo[4,5-b]pyridine-7-carbothioamide (PubChem CID 122686940) has the molecular formula C14H10ClFN4S and a molecular weight of 320.78 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-N-methyl-1H-imidazo[4,5-b]pyridine-7-carbothioamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-N-methyl-1H-imidazo[4,5-b]pyridine-7-carbothioamide |
|---|---|
| PubChem CID | 122686940 |
| Molecular Formula | C14H10ClFN4S |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-N-methyl-1H-imidazo[4,5-b]pyridine-7-carbothioamide |
| SMILES | CN(C(=S)c1ccnc2nc[nH]c12)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H10ClFN4S/c1-20(8-2-3-11(16)10(15)6-8)14(21)9-4-5-17-13-12(9)18-7-19-13/h2-7H,1H3,(H,17,18,19) |
| InChIKey | UXECPIZOXKQPQD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|