About 5-[2-[(3-chloro-2,6-difluorophenyl)methyl]-7H-purin-6-yl]pyrimidin-2-amine
5-[2-[(3-chloro-2,6-difluorophenyl)methyl]-7H-purin-6-yl]pyrimidin-2-amine (PubChem CID 142764143) has the molecular formula C16H10ClF2N7
and a molecular weight of 373.75 g/mol. Its IUPAC name is 5-[2-[(3-chloro-2,6-difluorophenyl)methyl]-7H-purin-6-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-[2-[(3-chloro-2,6-difluorophenyl)methyl]-7H-purin-6-yl]pyrimidin-2-amine |
| PubChem CID | 142764143 |
| Molecular Formula | C16H10ClF2N7 |
| Molecular Weight | 373.75 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 5-[2-[(3-chloro-2,6-difluorophenyl)methyl]-7H-purin-6-yl]pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2nc(Cc3c(F)ccc(Cl)c3F)nc3nc[nH]c23)cn1 |
| InChI | InChI=1S/C16H10ClF2N7/c17-9-1-2-10(18)8(12(9)19)3-11-25-13(7-4-21-16(20)22-5-7)14-15(26-11)24-6-23-14/h1-2,4-6H,3H2,(H2,20,21,22)(H,23,24,25,26) |
| InChIKey | FRKONGAEJKFZCC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.75 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-[(3-chloro-2,6-difluorophenyl)methyl]-7H-purin-6-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[(3-chloro-2,6-difluorophenyl)methyl]-7H-purin-6-yl]pyrimidin-2-amine?
The IUPAC name of 5-[2-[(3-chloro-2,6-difluorophenyl)methyl]-7H-purin-6-yl]pyrimidin-2-amine (CID 142764143) is 5-[2-[(3-chloro-2,6-difluorophenyl)methyl]-7H-purin-6-yl]pyrimidin-2-amine.
What is the SMILES notation for 5-[2-[(3-chloro-2,6-difluorophenyl)methyl]-7H-purin-6-yl]pyrimidin-2-amine?
The canonical SMILES for 5-[2-[(3-chloro-2,6-difluorophenyl)methyl]-7H-purin-6-yl]pyrimidin-2-amine is Nc1ncc(-c2nc(Cc3c(F)ccc(Cl)c3F)nc3nc[nH]c23)cn1.
What is the InChIKey of 5-[2-[(3-chloro-2,6-difluorophenyl)methyl]-7H-purin-6-yl]pyrimidin-2-amine?
The InChIKey is FRKONGAEJKFZCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClF2N7/c17-9-1-2-10(18)8(12(9)19)3-11-25-13(7-4-21-16(20)22-5-7)14-15(26-11)24-6-23-14/h1-2,4-6H,3H2,(H2,20,21,22)(H,23,24,25,26).
What are the key properties of 5-[2-[(3-chloro-2,6-difluorophenyl)methyl]-7H-purin-6-yl]pyrimidin-2-amine?
5-[2-[(3-chloro-2,6-difluorophenyl)methyl]-7H-purin-6-yl]pyrimidin-2-amine has a molecular weight of 373.75 g/mol, XLogP of 2.91, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[(3-chloro-2,6-difluorophenyl)methyl]-7H-purin-6-yl]pyrimidin-2-amine is sourced from PubChem (CID 142764143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).