C8H12N6 — CID 59881619
N-methyl-2-(methylaminomethyl)-7H-purin-6-amine (PubChem CID 59881619) has the molecular formula C8H12N6 and a molecular weight of 192.23 g/mol. Its IUPAC name is N-methyl-2-(methylaminomethyl)-7H-purin-6-amine.
| Compound Name | N-methyl-2-(methylaminomethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 59881619 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | N-methyl-2-(methylaminomethyl)-7H-purin-6-amine |
| SMILES | CNCc1nc(NC)c2[nH]cnc2n1 |
| InChI | InChI=1S/C8H12N6/c1-9-3-5-13-7(10-2)6-8(14-5)12-4-11-6/h4,9H,3H2,1-2H3,(H2,10,11,12,13,14) |
| InChIKey | GZAFTSGSBRDIIC-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |