C24H28N6 — CID 142057202
N-(2,2-diphenylethyl)-2-[(2-methylpropylamino)methyl]-7H-purin-6-amine (PubChem CID 142057202) has the molecular formula C24H28N6 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-2-[(2-methylpropylamino)methyl]-7H-purin-6-amine.
| Compound Name | N-(2,2-diphenylethyl)-2-[(2-methylpropylamino)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 142057202 |
| Molecular Formula | C24H28N6 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | N-(2,2-diphenylethyl)-2-[(2-methylpropylamino)methyl]-7H-purin-6-amine |
| SMILES | CC(C)CNCc1nc(NCC(c2ccccc2)c2ccccc2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C24H28N6/c1-17(2)13-25-15-21-29-23(22-24(30-21)28-16-27-22)26-14-20(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,16-17,20,25H,13-15H2,1-2H3,(H2,26,27,28,29,30) |
| InChIKey | YRVQIYPPNOGQNS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |