C19H18N6 — CID 139906156
6-N-(2,2-diphenylethyl)-7H-purine-2,6-diamine (PubChem CID 139906156) has the molecular formula C19H18N6 and a molecular weight of 330.40 g/mol. Its IUPAC name is 6-N-(2,2-diphenylethyl)-7H-purine-2,6-diamine.
| Compound Name | 6-N-(2,2-diphenylethyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 139906156 |
| Molecular Formula | C19H18N6 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 6-N-(2,2-diphenylethyl)-7H-purine-2,6-diamine |
| SMILES | Nc1nc(NCC(c2ccccc2)c2ccccc2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C19H18N6/c20-19-24-17(16-18(25-19)23-12-22-16)21-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,12,15H,11H2,(H4,20,21,22,23,24,25) |
| InChIKey | XGQLHNKCRZLNMX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |