C14H13N5O — CID 146553502
2-[2-(5-ethylfuran-2-yl)ethynyl]-N-methyl-7H-purin-6-amine (PubChem CID 146553502) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-[2-(5-ethylfuran-2-yl)ethynyl]-N-methyl-7H-purin-6-amine.
| Compound Name | 2-[2-(5-ethylfuran-2-yl)ethynyl]-N-methyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 146553502 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[2-(5-ethylfuran-2-yl)ethynyl]-N-methyl-7H-purin-6-amine |
| SMILES | CCc1ccc(C#Cc2nc(NC)c3[nH]cnc3n2)o1 |
| InChI | InChI=1S/C14H13N5O/c1-3-9-4-5-10(20-9)6-7-11-18-13(15-2)12-14(19-11)17-8-16-12/h4-5,8H,3H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | RSHDIRZZUBWIEN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|