C11H5Cl4IN2 — CID 66316635
4,6-dichloro-2-[(2,6-dichlorophenyl)methyl]-5-iodopyrimidine (PubChem CID 66316635) has the molecular formula C11H5Cl4IN2 and a molecular weight of 433.89 g/mol. Its IUPAC name is 4,6-dichloro-2-[(2,6-dichlorophenyl)methyl]-5-iodopyrimidine.
| Compound Name | 4,6-dichloro-2-[(2,6-dichlorophenyl)methyl]-5-iodopyrimidine |
|---|---|
| PubChem CID | 66316635 |
| Molecular Formula | C11H5Cl4IN2 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 431.83 |
| IUPAC Name | 4,6-dichloro-2-[(2,6-dichlorophenyl)methyl]-5-iodopyrimidine |
| SMILES | Clc1cccc(Cl)c1Cc1nc(Cl)c(I)c(Cl)n1 |
| InChI | InChI=1S/C11H5Cl4IN2/c12-6-2-1-3-7(13)5(6)4-8-17-10(14)9(16)11(15)18-8/h1-3H,4H2 |
| InChIKey | OZSNIXLGWWPYEN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|