C40H50N8O2Si — CID 142608815
N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-4-[3,7-bis(dimethylamino)-5,5-di(propan-2-yl)benzo[b][1]benzosilin-10-ylidene]butanamide (PubChem CID 142608815) has the molecular formula C40H50N8O2Si and a molecular weight of 702.98 g/mol. Its IUPAC name is N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-4-[3,7-bis(dimethylamino)-5,5-di(propan-2-yl)benzo[b][1]benzosilin-10-ylidene]butanamide.
| Compound Name | N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-4-[3,7-bis(dimethylamino)-5,5-di(propan-2-yl)benzo[b][1]benzosilin-10-ylidene]butanamide |
|---|---|
| PubChem CID | 142608815 |
| Molecular Formula | C40H50N8O2Si |
| Molecular Weight | 702.98 g/mol |
| Exact Mass | 702.38 |
| IUPAC Name | N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-4-[3,7-bis(dimethylamino)-5,5-di(propan-2-yl)benzo[b][1]benzosilin-10-ylidene]butanamide |
| SMILES | CC(C)[Si]1(C(C)C)c2cc(N(C)C)ccc2C(=CCCC(=O)NCc2ccc(COc3nc(N)nc4nc[nH]c34)cc2)c2ccc(N(C)C)cc21 |
| InChI | InChI=1S/C40H50N8O2Si/c1-25(2)51(26(3)4)34-20-29(47(5)6)16-18-32(34)31(33-19-17-30(48(7)8)21-35(33)51)10-9-11-36(49)42-22-27-12-14-28(15-13-27)23-50-39-37-38(44-24-43-37)45-40(41)46-39/h10,12-21,24-26H,9,11,22-23H2,1-8H3,(H,42,49)(H3,41,43,44,45,46) |
| InChIKey | PTXDAFGWAHFUCM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.98 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|