C39H39N13O6 — CID 71011405
N'-[[4-[[2-amino-7-[1-(2-nitrophenyl)ethyl]purin-6-yl]oxymethyl]phenyl]methyl]-N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]pentanediamide (PubChem CID 71011405) has the molecular formula C39H39N13O6 and a molecular weight of 785.83 g/mol. Its IUPAC name is N'-[[4-[[2-amino-7-[1-(2-nitrophenyl)ethyl]purin-6-yl]oxymethyl]phenyl]methyl]-N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]pentanediamide.
| Compound Name | N'-[[4-[[2-amino-7-[1-(2-nitrophenyl)ethyl]purin-6-yl]oxymethyl]phenyl]methyl]-N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]pentanediamide |
|---|---|
| PubChem CID | 71011405 |
| Molecular Formula | C39H39N13O6 |
| Molecular Weight | 785.83 g/mol |
| Exact Mass | 785.31 |
| IUPAC Name | N'-[[4-[[2-amino-7-[1-(2-nitrophenyl)ethyl]purin-6-yl]oxymethyl]phenyl]methyl]-N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]pentanediamide |
| SMILES | CC(c1ccccc1[N+](=O)[O-])n1cnc2nc(N)nc(OCc3ccc(CNC(=O)CCCC(=O)NCc4ccc(COc5nc(N)nc6nc[nH]c56)cc4)cc3)c21 |
| InChI | InChI=1S/C39H39N13O6/c1-23(28-5-2-3-6-29(28)52(55)56)51-22-46-35-33(51)37(50-39(41)48-35)58-20-27-15-11-25(12-16-27)18-43-31(54)8-4-7-30(53)42-17-24-9-13-26(14-10-24)19-57-36-32-34(45-21-44-32)47-38(40)49-36/h2-3,5-6,9-16,21-23H,4,7-8,17-20H2,1H3,(H,42,53)(H,43,54)(H2,41,48,50)(H3,40,44,45,47,49) |
| InChIKey | MAMZHDFXUOKICG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 269.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.83 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|