C15H18N8O2S — CID 167288355
2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(4-methoxypyrimidin-2-yl)-3-methylbutanamide (PubChem CID 167288355) has the molecular formula C15H18N8O2S and a molecular weight of 374.43 g/mol. Its IUPAC name is 2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(4-methoxypyrimidin-2-yl)-3-methylbutanamide.
| Compound Name | 2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(4-methoxypyrimidin-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 167288355 |
| Molecular Formula | C15H18N8O2S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(4-methoxypyrimidin-2-yl)-3-methylbutanamide |
| SMILES | COc1ccnc(NC(=O)C(Sc2nc(N)nc3nc[nH]c23)C(C)C)n1 |
| InChI | InChI=1S/C15H18N8O2S/c1-7(2)10(12(24)22-15-17-5-4-8(20-15)25-3)26-13-9-11(19-6-18-9)21-14(16)23-13/h4-7,10H,1-3H3,(H,17,20,22,24)(H3,16,18,19,21,23) |
| InChIKey | ORVWFBHEGSEPKD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 144.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |