C15H17N7O2S — CID 167288941
2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(4-methoxy-2-pyridinyl)-2-methylpropanamide (PubChem CID 167288941) has the molecular formula C15H17N7O2S and a molecular weight of 359.42 g/mol. Its IUPAC name is 2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(4-methoxy-2-pyridinyl)-2-methylpropanamide.
| Compound Name | 2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(4-methoxy-2-pyridinyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 167288941 |
| Molecular Formula | C15H17N7O2S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(4-methoxy-2-pyridinyl)-2-methylpropanamide |
| SMILES | COc1ccnc(NC(=O)C(C)(C)Sc2nc(N)nc3nc[nH]c23)c1 |
| InChI | InChI=1S/C15H17N7O2S/c1-15(2,13(23)20-9-6-8(24-3)4-5-17-9)25-12-10-11(19-7-18-10)21-14(16)22-12/h4-7H,1-3H3,(H,17,20,23)(H3,16,18,19,21,22) |
| InChIKey | HVBLBJOENPOOBM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |