C8H7N7 — CID 69250570
6-(1H-imidazol-2-yl)-7H-purin-2-amine (PubChem CID 69250570) has the molecular formula C8H7N7 and a molecular weight of 201.19 g/mol. Its IUPAC name is 6-(1H-imidazol-2-yl)-7H-purin-2-amine.
| Compound Name | 6-(1H-imidazol-2-yl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 69250570 |
| Molecular Formula | C8H7N7 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 6-(1H-imidazol-2-yl)-7H-purin-2-amine |
| SMILES | Nc1nc(-c2ncc[nH]2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C8H7N7/c9-8-14-5(6-10-1-2-11-6)4-7(15-8)13-3-12-4/h1-3H,(H,10,11)(H3,9,12,13,14,15) |
| InChIKey | BBBZTJXCDLQFBB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |