C17H18N8 — CID 70732467
6-[6-(cyclopentylamino)-1H-pyrrolo[2,3-b]pyridin-4-yl]-7H-purin-2-amine (PubChem CID 70732467) has the molecular formula C17H18N8 and a molecular weight of 334.39 g/mol. Its IUPAC name is 6-[6-(cyclopentylamino)-1H-pyrrolo[2,3-b]pyridin-4-yl]-7H-purin-2-amine.
| Compound Name | 6-[6-(cyclopentylamino)-1H-pyrrolo[2,3-b]pyridin-4-yl]-7H-purin-2-amine |
|---|---|
| PubChem CID | 70732467 |
| Molecular Formula | C17H18N8 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 6-[6-(cyclopentylamino)-1H-pyrrolo[2,3-b]pyridin-4-yl]-7H-purin-2-amine |
| SMILES | Nc1nc(-c2cc(NC3CCCC3)nc3[nH]ccc23)c2[nH]cnc2n1 |
| InChI | InChI=1S/C17H18N8/c18-17-24-13(14-16(25-17)21-8-20-14)11-7-12(22-9-3-1-2-4-9)23-15-10(11)5-6-19-15/h5-9H,1-4H2,(H2,19,22,23)(H3,18,20,21,24,25) |
| InChIKey | PDGWBBILDBAUHC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |