C14H13N7OS — CID 167288012
N-[2-[(2-amino-7H-purin-6-yl)sulfanyl]ethyl]-1,3-benzoxazol-2-amine (PubChem CID 167288012) has the molecular formula C14H13N7OS and a molecular weight of 327.37 g/mol. Its IUPAC name is N-[2-[(2-amino-7H-purin-6-yl)sulfanyl]ethyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[2-[(2-amino-7H-purin-6-yl)sulfanyl]ethyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 167288012 |
| Molecular Formula | C14H13N7OS |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-[2-[(2-amino-7H-purin-6-yl)sulfanyl]ethyl]-1,3-benzoxazol-2-amine |
| SMILES | Nc1nc(SCCNc2nc3ccccc3o2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H13N7OS/c15-13-20-11-10(17-7-18-11)12(21-13)23-6-5-16-14-19-8-3-1-2-4-9(8)22-14/h1-4,7H,5-6H2,(H,16,19)(H3,15,17,18,20,21) |
| InChIKey | MGZFKXHKEGLIHO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|