C18H18N4O2S — CID 22675440
N-[2-[2-(1H-benzimidazol-2-ylsulfanyl)ethoxy]ethyl]-1,3-benzoxazol-2-amine (PubChem CID 22675440) has the molecular formula C18H18N4O2S and a molecular weight of 354.43 g/mol. Its IUPAC name is N-[2-[2-(1H-benzimidazol-2-ylsulfanyl)ethoxy]ethyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[2-[2-(1H-benzimidazol-2-ylsulfanyl)ethoxy]ethyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 22675440 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[2-[2-(1H-benzimidazol-2-ylsulfanyl)ethoxy]ethyl]-1,3-benzoxazol-2-amine |
| SMILES | c1ccc2[nH]c(SCCOCCNc3nc4ccccc4o3)nc2c1 |
| InChI | InChI=1S/C18H18N4O2S/c1-2-6-14-13(5-1)21-18(22-14)25-12-11-23-10-9-19-17-20-15-7-3-4-8-16(15)24-17/h1-8H,9-12H2,(H,19,20)(H,21,22) |
| InChIKey | NIAIDUODEVWKAM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|