C23H23N5O2S — CID 67102376
4-[[8-[[benzyl(methyl)amino]methyl]quinazolin-2-yl]amino]benzenesulfonamide (PubChem CID 67102376) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is 4-[[8-[[benzyl(methyl)amino]methyl]quinazolin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[8-[[benzyl(methyl)amino]methyl]quinazolin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 67102376 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 4-[[8-[[benzyl(methyl)amino]methyl]quinazolin-2-yl]amino]benzenesulfonamide |
| SMILES | CN(Cc1ccccc1)Cc1cccc2cnc(Nc3ccc(S(N)(=O)=O)cc3)nc12 |
| InChI | InChI=1S/C23H23N5O2S/c1-28(15-17-6-3-2-4-7-17)16-19-9-5-8-18-14-25-23(27-22(18)19)26-20-10-12-21(13-11-20)31(24,29)30/h2-14H,15-16H2,1H3,(H2,24,29,30)(H,25,26,27) |
| InChIKey | WFBCYZGVDJMQPR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |