C16H13N7O2S — CID 24962848
3-[[4-(1H-benzimidazol-4-yl)-1,3,5-triazin-2-yl]amino]benzenesulfonamide (PubChem CID 24962848) has the molecular formula C16H13N7O2S and a molecular weight of 367.39 g/mol. Its IUPAC name is 3-[[4-(1H-benzimidazol-4-yl)-1,3,5-triazin-2-yl]amino]benzenesulfonamide.
| Compound Name | 3-[[4-(1H-benzimidazol-4-yl)-1,3,5-triazin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 24962848 |
| Molecular Formula | C16H13N7O2S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 3-[[4-(1H-benzimidazol-4-yl)-1,3,5-triazin-2-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(Nc2ncnc(-c3cccc4[nH]cnc34)n2)c1 |
| InChI | InChI=1S/C16H13N7O2S/c17-26(24,25)11-4-1-3-10(7-11)22-16-21-9-20-15(23-16)12-5-2-6-13-14(12)19-8-18-13/h1-9H,(H,18,19)(H2,17,24,25)(H,20,21,22,23) |
| InChIKey | FWQMMXRYTLQLCQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |