C15H20N6O3S — CID 171849376
3-[(5-methoxy-4-piperazin-1-ylpyrimidin-2-yl)amino]benzenesulfonamide (PubChem CID 171849376) has the molecular formula C15H20N6O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is 3-[(5-methoxy-4-piperazin-1-ylpyrimidin-2-yl)amino]benzenesulfonamide.
| Compound Name | 3-[(5-methoxy-4-piperazin-1-ylpyrimidin-2-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 171849376 |
| Molecular Formula | C15H20N6O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 3-[(5-methoxy-4-piperazin-1-ylpyrimidin-2-yl)amino]benzenesulfonamide |
| SMILES | COc1cnc(Nc2cccc(S(N)(=O)=O)c2)nc1N1CCNCC1 |
| InChI | InChI=1S/C15H20N6O3S/c1-24-13-10-18-15(20-14(13)21-7-5-17-6-8-21)19-11-3-2-4-12(9-11)25(16,22)23/h2-4,9-10,17H,5-8H2,1H3,(H2,16,22,23)(H,18,19,20) |
| InChIKey | RCTKPVIQGCCIMM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |