C19H19N7O3 — CID 117087762
2-N-pyridin-3-yl-6-N-(3,4,5-trimethoxyphenyl)-7H-purine-2,6-diamine (PubChem CID 117087762) has the molecular formula C19H19N7O3 and a molecular weight of 393.41 g/mol. Its IUPAC name is 2-N-pyridin-3-yl-6-N-(3,4,5-trimethoxyphenyl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-pyridin-3-yl-6-N-(3,4,5-trimethoxyphenyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 117087762 |
| Molecular Formula | C19H19N7O3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 2-N-pyridin-3-yl-6-N-(3,4,5-trimethoxyphenyl)-7H-purine-2,6-diamine |
| SMILES | COc1cc(Nc2nc(Nc3cccnc3)nc3nc[nH]c23)cc(OC)c1OC |
| InChI | InChI=1S/C19H19N7O3/c1-27-13-7-12(8-14(28-2)16(13)29-3)23-18-15-17(22-10-21-15)25-19(26-18)24-11-5-4-6-20-9-11/h4-10H,1-3H3,(H3,21,22,23,24,25,26) |
| InChIKey | OJDBUPIQPCVGKD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 119.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |