C21H19N5O4S2 — CID 71607951
2-methyl-4-[4-(4-sulfamoylanilino)phthalazin-1-yl]benzenesulfonamide (PubChem CID 71607951) has the molecular formula C21H19N5O4S2 and a molecular weight of 469.55 g/mol. Its IUPAC name is 2-methyl-4-[4-(4-sulfamoylanilino)phthalazin-1-yl]benzenesulfonamide.
| Compound Name | 2-methyl-4-[4-(4-sulfamoylanilino)phthalazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 71607951 |
| Molecular Formula | C21H19N5O4S2 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 2-methyl-4-[4-(4-sulfamoylanilino)phthalazin-1-yl]benzenesulfonamide |
| SMILES | Cc1cc(-c2nnc(Nc3ccc(S(N)(=O)=O)cc3)c3ccccc23)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C21H19N5O4S2/c1-13-12-14(6-11-19(13)32(23,29)30)20-17-4-2-3-5-18(17)21(26-25-20)24-15-7-9-16(10-8-15)31(22,27)28/h2-12H,1H3,(H,24,26)(H2,22,27,28)(H2,23,29,30) |
| InChIKey | VGWGODQLJSCOSQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |