C27H23N5O3S — CID 86267259
5-[4-[(2-methoxyphenyl)methylamino]-5-phenylphthalazin-1-yl]pyridine-3-sulfonamide (PubChem CID 86267259) has the molecular formula C27H23N5O3S and a molecular weight of 497.58 g/mol. Its IUPAC name is 5-[4-[(2-methoxyphenyl)methylamino]-5-phenylphthalazin-1-yl]pyridine-3-sulfonamide.
| Compound Name | 5-[4-[(2-methoxyphenyl)methylamino]-5-phenylphthalazin-1-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 86267259 |
| Molecular Formula | C27H23N5O3S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 5-[4-[(2-methoxyphenyl)methylamino]-5-phenylphthalazin-1-yl]pyridine-3-sulfonamide |
| SMILES | COc1ccccc1CNc1nnc(-c2cncc(S(N)(=O)=O)c2)c2cccc(-c3ccccc3)c12 |
| InChI | InChI=1S/C27H23N5O3S/c1-35-24-13-6-5-10-19(24)16-30-27-25-22(18-8-3-2-4-9-18)11-7-12-23(25)26(31-32-27)20-14-21(17-29-15-20)36(28,33)34/h2-15,17H,16H2,1H3,(H,30,32)(H2,28,33,34) |
| InChIKey | LOAWDYASILKXAB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |