C27H23N5O2S — CID 86268298
5-[5-phenyl-4-[[(1R)-1-phenylethyl]amino]phthalazin-1-yl]pyridine-3-sulfonamide (PubChem CID 86268298) has the molecular formula C27H23N5O2S and a molecular weight of 481.58 g/mol. Its IUPAC name is 5-[5-phenyl-4-[[(1R)-1-phenylethyl]amino]phthalazin-1-yl]pyridine-3-sulfonamide.
| Compound Name | 5-[5-phenyl-4-[[(1R)-1-phenylethyl]amino]phthalazin-1-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 86268298 |
| Molecular Formula | C27H23N5O2S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 5-[5-phenyl-4-[[(1R)-1-phenylethyl]amino]phthalazin-1-yl]pyridine-3-sulfonamide |
| SMILES | C[C@@H](Nc1nnc(-c2cncc(S(N)(=O)=O)c2)c2cccc(-c3ccccc3)c12)c1ccccc1 |
| InChI | InChI=1S/C27H23N5O2S/c1-18(19-9-4-2-5-10-19)30-27-25-23(20-11-6-3-7-12-20)13-8-14-24(25)26(31-32-27)21-15-22(17-29-16-21)35(28,33)34/h2-18H,1H3,(H,30,32)(H2,28,33,34)/t18-/m1/s1 |
| InChIKey | NUIVMMIECAJKRS-GOSISDBHSA-N |
| XLogP | 5.18 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |