C27H22N6O — CID 86270485
[5-[4-(benzylamino)-5-phenylphthalazin-1-yl]-3-pyridinyl]urea (PubChem CID 86270485) has the molecular formula C27H22N6O and a molecular weight of 446.51 g/mol. Its IUPAC name is [5-[4-(benzylamino)-5-phenylphthalazin-1-yl]-3-pyridinyl]urea.
| Compound Name | [5-[4-(benzylamino)-5-phenylphthalazin-1-yl]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 86270485 |
| Molecular Formula | C27H22N6O |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [5-[4-(benzylamino)-5-phenylphthalazin-1-yl]-3-pyridinyl]urea |
| SMILES | NC(=O)Nc1cncc(-c2nnc(NCc3ccccc3)c3c(-c4ccccc4)cccc23)c1 |
| InChI | InChI=1S/C27H22N6O/c28-27(34)31-21-14-20(16-29-17-21)25-23-13-7-12-22(19-10-5-2-6-11-19)24(23)26(33-32-25)30-15-18-8-3-1-4-9-18/h1-14,16-17H,15H2,(H,30,33)(H3,28,31,34) |
| InChIKey | JHQKOINYOHFAQU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |