C28H22ClN3 — CID 144706407
N-benzyl-3-chloro-4-(5-methyl-3-pyridinyl)-8-phenylisoquinolin-1-amine (PubChem CID 144706407) has the molecular formula C28H22ClN3 and a molecular weight of 435.96 g/mol. Its IUPAC name is N-benzyl-3-chloro-4-(5-methyl-3-pyridinyl)-8-phenylisoquinolin-1-amine.
| Compound Name | N-benzyl-3-chloro-4-(5-methyl-3-pyridinyl)-8-phenylisoquinolin-1-amine |
|---|---|
| PubChem CID | 144706407 |
| Molecular Formula | C28H22ClN3 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N-benzyl-3-chloro-4-(5-methyl-3-pyridinyl)-8-phenylisoquinolin-1-amine |
| SMILES | Cc1cncc(-c2c(Cl)nc(NCc3ccccc3)c3c(-c4ccccc4)cccc23)c1 |
| InChI | InChI=1S/C28H22ClN3/c1-19-15-22(18-30-16-19)25-24-14-8-13-23(21-11-6-3-7-12-21)26(24)28(32-27(25)29)31-17-20-9-4-2-5-10-20/h2-16,18H,17H2,1H3,(H,31,32) |
| InChIKey | UIPLCWGSULVMCG-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|