C28H23ClN4O2S — CID 118659283
N-[4-[3-chloro-8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-4-yl]phenyl]methanesulfonamide (PubChem CID 118659283) has the molecular formula C28H23ClN4O2S and a molecular weight of 515.04 g/mol. Its IUPAC name is N-[4-[3-chloro-8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-4-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[3-chloro-8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-4-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 118659283 |
| Molecular Formula | C28H23ClN4O2S |
| Molecular Weight | 515.04 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | N-[4-[3-chloro-8-phenyl-1-(pyridin-2-ylmethylamino)isoquinolin-4-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2c(Cl)nc(NCc3ccccn3)c3c(-c4ccccc4)cccc23)cc1 |
| InChI | InChI=1S/C28H23ClN4O2S/c1-36(34,35)33-21-15-13-20(14-16-21)25-24-12-7-11-23(19-8-3-2-4-9-19)26(24)28(32-27(25)29)31-18-22-10-5-6-17-30-22/h2-17,33H,18H2,1H3,(H,31,32) |
| InChIKey | CKUFFGNKUBJBFT-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.04 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|