C24H19N7O2S — CID 51029627
6-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]pyrazine-2-sulfonamide (PubChem CID 51029627) has the molecular formula C24H19N7O2S and a molecular weight of 469.53 g/mol. Its IUPAC name is 6-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]pyrazine-2-sulfonamide.
| Compound Name | 6-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]pyrazine-2-sulfonamide |
|---|---|
| PubChem CID | 51029627 |
| Molecular Formula | C24H19N7O2S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 6-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]pyrazine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cncc(-c2nc(NCc3ccccn3)c3c(-c4ccccc4)cccc3n2)n1 |
| InChI | InChI=1S/C24H19N7O2S/c25-34(32,33)21-15-26-14-20(29-21)23-30-19-11-6-10-18(16-7-2-1-3-8-16)22(19)24(31-23)28-13-17-9-4-5-12-27-17/h1-12,14-15H,13H2,(H2,25,32,33)(H,28,30,31) |
| InChIKey | MUQYRIDVHPKYKS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |