C26H22N6OS — CID 139377274
N-methyl-5-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]pyridine-3-sulfinamide (PubChem CID 139377274) has the molecular formula C26H22N6OS and a molecular weight of 466.57 g/mol. Its IUPAC name is N-methyl-5-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]pyridine-3-sulfinamide.
| Compound Name | N-methyl-5-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]pyridine-3-sulfinamide |
|---|---|
| PubChem CID | 139377274 |
| Molecular Formula | C26H22N6OS |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | N-methyl-5-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]pyridine-3-sulfinamide |
| SMILES | CNS(=O)c1cncc(-c2nc(NCc3ccccn3)c3c(-c4ccccc4)cccc3n2)c1 |
| InChI | InChI=1S/C26H22N6OS/c1-27-34(33)21-14-19(15-28-17-21)25-31-23-12-7-11-22(18-8-3-2-4-9-18)24(23)26(32-25)30-16-20-10-5-6-13-29-20/h2-15,17,27H,16H2,1H3,(H,30,31,32) |
| InChIKey | NQKRDQIHDKRKDR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |